C11H23N5 — CID 105259282
4-(2,5-dimethylpyrazol-3-yl)-3-hydrazinyl-N,N-dimethylbutan-1-amine (PubChem CID 105259282) has the molecular formula C11H23N5 and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrazol-3-yl)-3-hydrazinyl-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(2,5-dimethylpyrazol-3-yl)-3-hydrazinyl-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 105259282 |
| Molecular Formula | C11H23N5 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.20 |
| IUPAC Name | 4-(2,5-dimethylpyrazol-3-yl)-3-hydrazinyl-N,N-dimethylbutan-1-amine |
| SMILES | Cc1cc(CC(CCN(C)C)NN)n(C)n1 |
| InChI | InChI=1S/C11H23N5/c1-9-7-11(16(4)14-9)8-10(13-12)5-6-15(2)3/h7,10,13H,5-6,8,12H2,1-4H3 |
| InChIKey | PFIXPQUHEGSONS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|