C15H23N5 — CID 105315713
4-[2-(2,5-dimethylpyrazol-3-yl)-1-hydrazinylethyl]-N,N-dimethylaniline (PubChem CID 105315713) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-[2-(2,5-dimethylpyrazol-3-yl)-1-hydrazinylethyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(2,5-dimethylpyrazol-3-yl)-1-hydrazinylethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 105315713 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 4-[2-(2,5-dimethylpyrazol-3-yl)-1-hydrazinylethyl]-N,N-dimethylaniline |
| SMILES | Cc1cc(CC(NN)c2ccc(N(C)C)cc2)n(C)n1 |
| InChI | InChI=1S/C15H23N5/c1-11-9-14(20(4)18-11)10-15(17-16)12-5-7-13(8-6-12)19(2)3/h5-9,15,17H,10,16H2,1-4H3 |
| InChIKey | VOJSCZZLDQGTPP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|