C11H22N4O — CID 105225066
[1-(2,5-dimethylpyrazol-3-yl)-5-methoxypentan-2-yl]hydrazine (PubChem CID 105225066) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is [1-(2,5-dimethylpyrazol-3-yl)-5-methoxypentan-2-yl]hydrazine.
| Compound Name | [1-(2,5-dimethylpyrazol-3-yl)-5-methoxypentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105225066 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | [1-(2,5-dimethylpyrazol-3-yl)-5-methoxypentan-2-yl]hydrazine |
| SMILES | COCCCC(Cc1cc(C)nn1C)NN |
| InChI | InChI=1S/C11H22N4O/c1-9-7-11(15(2)14-9)8-10(13-12)5-4-6-16-3/h7,10,13H,4-6,8,12H2,1-3H3 |
| InChIKey | PACGITPIXFDWMV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|