C17H33N3 — CID 104996240
1-(2,5-dimethylpyrazol-3-yl)-N-methylundecan-2-amine (PubChem CID 104996240) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrazol-3-yl)-N-methylundecan-2-amine.
| Compound Name | 1-(2,5-dimethylpyrazol-3-yl)-N-methylundecan-2-amine |
|---|---|
| PubChem CID | 104996240 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 1-(2,5-dimethylpyrazol-3-yl)-N-methylundecan-2-amine |
| SMILES | CCCCCCCCCC(Cc1cc(C)nn1C)NC |
| InChI | InChI=1S/C17H33N3/c1-5-6-7-8-9-10-11-12-16(18-3)14-17-13-15(2)19-20(17)4/h13,16,18H,5-12,14H2,1-4H3 |
| InChIKey | ABSYTFDOAZYGJZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|