C16H24N4 — CID 105315883
[1-(2,5-dimethylphenyl)-3-(2,5-dimethylpyrazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105315883) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is [1-(2,5-dimethylphenyl)-3-(2,5-dimethylpyrazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(2,5-dimethylphenyl)-3-(2,5-dimethylpyrazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105315883 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | [1-(2,5-dimethylphenyl)-3-(2,5-dimethylpyrazol-3-yl)propan-2-yl]hydrazine |
| SMILES | Cc1ccc(C)c(CC(Cc2cc(C)nn2C)NN)c1 |
| InChI | InChI=1S/C16H24N4/c1-11-5-6-12(2)14(7-11)9-15(18-17)10-16-8-13(3)19-20(16)4/h5-8,15,18H,9-10,17H2,1-4H3 |
| InChIKey | HXQQRBHYERZRIS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|