C10H19N3O — CID 79617156
1-(2,5-dimethylpyrazol-3-yl)-3-methoxybutan-2-amine (PubChem CID 79617156) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrazol-3-yl)-3-methoxybutan-2-amine.
| Compound Name | 1-(2,5-dimethylpyrazol-3-yl)-3-methoxybutan-2-amine |
|---|---|
| PubChem CID | 79617156 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-(2,5-dimethylpyrazol-3-yl)-3-methoxybutan-2-amine |
| SMILES | COC(C)C(N)Cc1cc(C)nn1C |
| InChI | InChI=1S/C10H19N3O/c1-7-5-9(13(3)12-7)6-10(11)8(2)14-4/h5,8,10H,6,11H2,1-4H3 |
| InChIKey | QXVXEHCVXSOEEJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |