C11H21N3O — CID 79616916
1-(2-ethyl-5-methylpyrazol-3-yl)-3-methoxybutan-2-amine (PubChem CID 79616916) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-(2-ethyl-5-methylpyrazol-3-yl)-3-methoxybutan-2-amine.
| Compound Name | 1-(2-ethyl-5-methylpyrazol-3-yl)-3-methoxybutan-2-amine |
|---|---|
| PubChem CID | 79616916 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-(2-ethyl-5-methylpyrazol-3-yl)-3-methoxybutan-2-amine |
| SMILES | CCn1nc(C)cc1CC(N)C(C)OC |
| InChI | InChI=1S/C11H21N3O/c1-5-14-10(6-8(2)13-14)7-11(12)9(3)15-4/h6,9,11H,5,7,12H2,1-4H3 |
| InChIKey | DPGHQFRGYHFFQL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |