C13H23BrN2 — CID 66047676
5-[2-(bromomethyl)-4-methylpentyl]-1-ethyl-3-methylpyrazole (PubChem CID 66047676) has the molecular formula C13H23BrN2 and a molecular weight of 287.25 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-4-methylpentyl]-1-ethyl-3-methylpyrazole.
| Compound Name | 5-[2-(bromomethyl)-4-methylpentyl]-1-ethyl-3-methylpyrazole |
|---|---|
| PubChem CID | 66047676 |
| Molecular Formula | C13H23BrN2 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-[2-(bromomethyl)-4-methylpentyl]-1-ethyl-3-methylpyrazole |
| SMILES | CCn1nc(C)cc1CC(CBr)CC(C)C |
| InChI | InChI=1S/C13H23BrN2/c1-5-16-13(7-11(4)15-16)8-12(9-14)6-10(2)3/h7,10,12H,5-6,8-9H2,1-4H3 |
| InChIKey | QFFVIHNYJQZSNA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|