C12H22N2O2 — CID 103454836
1-(2-ethyl-5-methylpyrazol-3-yl)hexane-2,3-diol (PubChem CID 103454836) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-(2-ethyl-5-methylpyrazol-3-yl)hexane-2,3-diol.
| Compound Name | 1-(2-ethyl-5-methylpyrazol-3-yl)hexane-2,3-diol |
|---|---|
| PubChem CID | 103454836 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-(2-ethyl-5-methylpyrazol-3-yl)hexane-2,3-diol |
| SMILES | CCCC(O)C(O)Cc1cc(C)nn1CC |
| InChI | InChI=1S/C12H22N2O2/c1-4-6-11(15)12(16)8-10-7-9(3)13-14(10)5-2/h7,11-12,15-16H,4-6,8H2,1-3H3 |
| InChIKey | VGTIDBUFCNITOK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |