C12H22N2O — CID 115811450
1-(2,5-dimethylpyrazol-3-yl)-3,4-dimethylpentan-2-ol (PubChem CID 115811450) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrazol-3-yl)-3,4-dimethylpentan-2-ol.
| Compound Name | 1-(2,5-dimethylpyrazol-3-yl)-3,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 115811450 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 1-(2,5-dimethylpyrazol-3-yl)-3,4-dimethylpentan-2-ol |
| SMILES | Cc1cc(CC(O)C(C)C(C)C)n(C)n1 |
| InChI | InChI=1S/C12H22N2O/c1-8(2)10(4)12(15)7-11-6-9(3)13-14(11)5/h6,8,10,12,15H,7H2,1-5H3 |
| InChIKey | ISMROSKLIMEKNC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |