C11H25NO — CID 102981288
N,3-dimethyl-1-pentan-2-yloxybutan-2-amine (PubChem CID 102981288) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is N,3-dimethyl-1-pentan-2-yloxybutan-2-amine.
| Compound Name | N,3-dimethyl-1-pentan-2-yloxybutan-2-amine |
|---|---|
| PubChem CID | 102981288 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | N,3-dimethyl-1-pentan-2-yloxybutan-2-amine |
| SMILES | CCCC(C)OCC(NC)C(C)C |
| InChI | InChI=1S/C11H25NO/c1-6-7-10(4)13-8-11(12-5)9(2)3/h9-12H,6-8H2,1-5H3 |
| InChIKey | VEVBDTNKQVXTSL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |