C16H35NO3 — CID 104564547
6-[2-(2-butoxyethoxy)ethoxy]-N,2-dimethylhexan-3-amine (PubChem CID 104564547) has the molecular formula C16H35NO3 and a molecular weight of 289.46 g/mol. Its IUPAC name is 6-[2-(2-butoxyethoxy)ethoxy]-N,2-dimethylhexan-3-amine.
| Compound Name | 6-[2-(2-butoxyethoxy)ethoxy]-N,2-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 104564547 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | 6-[2-(2-butoxyethoxy)ethoxy]-N,2-dimethylhexan-3-amine |
| SMILES | CCCCOCCOCCOCCCC(NC)C(C)C |
| InChI | InChI=1S/C16H35NO3/c1-5-6-9-18-11-13-20-14-12-19-10-7-8-16(17-4)15(2)3/h15-17H,5-14H2,1-4H3 |
| InChIKey | VDMWNDQTBGPOJD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|