C17H37NO3 — CID 104564635
3-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N,4-dimethylpentan-2-amine (PubChem CID 104564635) has the molecular formula C17H37NO3 and a molecular weight of 303.49 g/mol. Its IUPAC name is 3-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N,4-dimethylpentan-2-amine.
| Compound Name | 3-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 104564635 |
| Molecular Formula | C17H37NO3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.28 |
| IUPAC Name | 3-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-N,4-dimethylpentan-2-amine |
| SMILES | CCCCOCCOCCOCCC(C(C)C)C(C)NC |
| InChI | InChI=1S/C17H37NO3/c1-6-7-9-19-11-13-21-14-12-20-10-8-17(15(2)3)16(4)18-5/h15-18H,6-14H2,1-5H3 |
| InChIKey | YZLZGVXODDBSOQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|