About (4S)-N,2,3-trimethylhept-1-en-4-amine
(4S)-N,2,3-trimethylhept-1-en-4-amine (PubChem CID 174109197) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is (4S)-N,2,3-trimethylhept-1-en-4-amine.
Molecular Properties
| Compound Name | (4S)-N,2,3-trimethylhept-1-en-4-amine |
| PubChem CID | 174109197 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | (4S)-N,2,3-trimethylhept-1-en-4-amine |
| SMILES | C=C(C)C(C)[C@H](CCC)NC |
| InChI | InChI=1S/C10H21N/c1-6-7-10(11-5)9(4)8(2)3/h9-11H,2,6-7H2,1,3-5H3/t9?,10-/m0/s1 |
| InChIKey | OQVYILYTQXKUCZ-AXDSSHIGSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-N,2,3-trimethylhept-1-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-N,2,3-trimethylhept-1-en-4-amine?
The IUPAC name of (4S)-N,2,3-trimethylhept-1-en-4-amine (CID 174109197) is (4S)-N,2,3-trimethylhept-1-en-4-amine.
What is the SMILES notation for (4S)-N,2,3-trimethylhept-1-en-4-amine?
The canonical SMILES for (4S)-N,2,3-trimethylhept-1-en-4-amine is C=C(C)C(C)[C@H](CCC)NC.
What is the InChIKey of (4S)-N,2,3-trimethylhept-1-en-4-amine?
The InChIKey is OQVYILYTQXKUCZ-AXDSSHIGSA-N. The full InChI is InChI=1S/C10H21N/c1-6-7-10(11-5)9(4)8(2)3/h9-11H,2,6-7H2,1,3-5H3/t9?,10-/m0/s1.
What are the key properties of (4S)-N,2,3-trimethylhept-1-en-4-amine?
(4S)-N,2,3-trimethylhept-1-en-4-amine has a molecular weight of 155.28 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-N,2,3-trimethylhept-1-en-4-amine is sourced from PubChem (CID 174109197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).