About ethane;3-methylhexane;N-methylprop-1-en-2-amine
ethane;3-methylhexane;N-methylprop-1-en-2-amine (PubChem CID 143357594) has the molecular formula C15H37N
and a molecular weight of 231.47 g/mol. Its IUPAC name is ethane;3-methylhexane;N-methylprop-1-en-2-amine.
Molecular Properties
| Compound Name | ethane;3-methylhexane;N-methylprop-1-en-2-amine |
| PubChem CID | 143357594 |
| Molecular Formula | C15H37N |
| Molecular Weight | 231.47 g/mol |
| Exact Mass | 231.29 |
| IUPAC Name | ethane;3-methylhexane;N-methylprop-1-en-2-amine |
| SMILES | C=C(C)NC.CC.CC.CCCC(C)CC |
| InChI | InChI=1S/C7H16.C4H9N.2C2H6/c1-4-6-7(3)5-2;1-4(2)5-3;2*1-2/h7H,4-6H2,1-3H3;5H,1H2,2-3H3;2*1-2H3 |
| InChIKey | FQFVBPWJRROBGQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 231.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-methylhexane;N-methylprop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylhexane;N-methylprop-1-en-2-amine?
The IUPAC name of ethane;3-methylhexane;N-methylprop-1-en-2-amine (CID 143357594) is ethane;3-methylhexane;N-methylprop-1-en-2-amine.
What is the SMILES notation for ethane;3-methylhexane;N-methylprop-1-en-2-amine?
The canonical SMILES for ethane;3-methylhexane;N-methylprop-1-en-2-amine is C=C(C)NC.CC.CC.CCCC(C)CC.
What is the InChIKey of ethane;3-methylhexane;N-methylprop-1-en-2-amine?
The InChIKey is FQFVBPWJRROBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C4H9N.2C2H6/c1-4-6-7(3)5-2;1-4(2)5-3;2*1-2/h7H,4-6H2,1-3H3;5H,1H2,2-3H3;2*1-2H3.
What are the key properties of ethane;3-methylhexane;N-methylprop-1-en-2-amine?
ethane;3-methylhexane;N-methylprop-1-en-2-amine has a molecular weight of 231.47 g/mol, XLogP of 5.62, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylhexane;N-methylprop-1-en-2-amine is sourced from PubChem (CID 143357594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).