C11H22 — CID 123682074
2,7-dimethylnon-1-ene (PubChem CID 123682074) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is 2,7-dimethylnon-1-ene.
| Compound Name | 2,7-dimethylnon-1-ene |
|---|---|
| PubChem CID | 123682074 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 2,7-dimethylnon-1-ene |
| SMILES | C=C(C)CCCCC(C)CC |
| InChI | InChI=1S/C11H22/c1-5-11(4)9-7-6-8-10(2)3/h11H,2,5-9H2,1,3-4H3 |
| InChIKey | QLTGTLZOOCWOTQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|