C27H52 — CID 143234953
(E)-3,8-dimethyl-11-(4-methylpent-4-enyl)nonadec-9-ene (PubChem CID 143234953) has the molecular formula C27H52 and a molecular weight of 376.71 g/mol. Its IUPAC name is (E)-3,8-dimethyl-11-(4-methylpent-4-enyl)nonadec-9-ene.
| Compound Name | (E)-3,8-dimethyl-11-(4-methylpent-4-enyl)nonadec-9-ene |
|---|---|
| PubChem CID | 143234953 |
| Molecular Formula | C27H52 |
| Molecular Weight | 376.71 g/mol |
| Exact Mass | 376.41 |
| IUPAC Name | (E)-3,8-dimethyl-11-(4-methylpent-4-enyl)nonadec-9-ene |
| SMILES | C=C(C)CCCC(/C=C/C(C)CCCCC(C)CC)CCCCCCCC |
| InChI | InChI=1S/C27H52/c1-7-9-10-11-12-13-20-27(21-16-17-24(3)4)23-22-26(6)19-15-14-18-25(5)8-2/h22-23,25-27H,3,7-21H2,1-2,4-6H3/b23-22+ |
| InChIKey | GWZFVTQLTQKNNH-GHVJWSGMSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.71 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|