C12H24O — CID 92860070
(3S,5S)-5,9-dimethyldec-9-en-3-ol (PubChem CID 92860070) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (3S,5S)-5,9-dimethyldec-9-en-3-ol.
| Compound Name | (3S,5S)-5,9-dimethyldec-9-en-3-ol |
|---|---|
| PubChem CID | 92860070 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (3S,5S)-5,9-dimethyldec-9-en-3-ol |
| SMILES | C=C(C)CCC[C@H](C)C[C@@H](O)CC |
| InChI | InChI=1S/C12H24O/c1-5-12(13)9-11(4)8-6-7-10(2)3/h11-13H,2,5-9H2,1,3-4H3/t11-,12-/m0/s1 |
| InChIKey | CNGGPKWJEPGPQH-RYUDHWBXSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|