C22H44 — CID 123611134
13-ethyl-2,11,14-trimethylheptadec-1-ene (PubChem CID 123611134) has the molecular formula C22H44 and a molecular weight of 308.59 g/mol. Its IUPAC name is 13-ethyl-2,11,14-trimethylheptadec-1-ene.
| Compound Name | 13-ethyl-2,11,14-trimethylheptadec-1-ene |
|---|---|
| PubChem CID | 123611134 |
| Molecular Formula | C22H44 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 308.34 |
| IUPAC Name | 13-ethyl-2,11,14-trimethylheptadec-1-ene |
| SMILES | C=C(C)CCCCCCCCC(C)CC(CC)C(C)CCC |
| InChI | InChI=1S/C22H44/c1-7-15-21(6)22(8-2)18-20(5)17-14-12-10-9-11-13-16-19(3)4/h20-22H,3,7-18H2,1-2,4-6H3 |
| InChIKey | NRBFGRAEAMXPOL-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|