About 8-methylnon-8-en-4-amine
8-methylnon-8-en-4-amine (PubChem CID 79185360) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is 8-methylnon-8-en-4-amine.
Molecular Properties
| Compound Name | 8-methylnon-8-en-4-amine |
| PubChem CID | 79185360 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 8-methylnon-8-en-4-amine |
| SMILES | C=C(C)CCCC(N)CCC |
| InChI | InChI=1S/C10H21N/c1-4-6-10(11)8-5-7-9(2)3/h10H,2,4-8,11H2,1,3H3 |
| InChIKey | JUTREFGUWLUAIA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methylnon-8-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylnon-8-en-4-amine?
The IUPAC name of 8-methylnon-8-en-4-amine (CID 79185360) is 8-methylnon-8-en-4-amine.
What is the SMILES notation for 8-methylnon-8-en-4-amine?
The canonical SMILES for 8-methylnon-8-en-4-amine is C=C(C)CCCC(N)CCC.
What is the InChIKey of 8-methylnon-8-en-4-amine?
The InChIKey is JUTREFGUWLUAIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-4-6-10(11)8-5-7-9(2)3/h10H,2,4-8,11H2,1,3H3.
What are the key properties of 8-methylnon-8-en-4-amine?
8-methylnon-8-en-4-amine has a molecular weight of 155.28 g/mol, XLogP of 2.86, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylnon-8-en-4-amine is sourced from PubChem (CID 79185360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).