C23H44S — CID 167082947
5-ethyl-2,11-dimethyl-13-propylhexadeca-1,14-diene-6-thiol (PubChem CID 167082947) has the molecular formula C23H44S and a molecular weight of 352.67 g/mol. Its IUPAC name is 5-ethyl-2,11-dimethyl-13-propylhexadeca-1,14-diene-6-thiol.
| Compound Name | 5-ethyl-2,11-dimethyl-13-propylhexadeca-1,14-diene-6-thiol |
|---|---|
| PubChem CID | 167082947 |
| Molecular Formula | C23H44S |
| Molecular Weight | 352.67 g/mol |
| Exact Mass | 352.32 |
| IUPAC Name | 5-ethyl-2,11-dimethyl-13-propylhexadeca-1,14-diene-6-thiol |
| SMILES | C=C(C)CCC(CC)C(S)CCCCC(C)CC(C=CC)CCC |
| InChI | InChI=1S/C23H44S/c1-7-12-21(13-8-2)18-20(6)14-10-11-15-23(24)22(9-3)17-16-19(4)5/h7,12,20-24H,4,8-11,13-18H2,1-3,5-6H3 |
| InChIKey | QIRYQRPYXFQBRK-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.67 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|