C20H38 — CID 123355574
2,4,6,8-tetramethyl-5-prop-1-enyltridec-1-ene (PubChem CID 123355574) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-5-prop-1-enyltridec-1-ene.
| Compound Name | 2,4,6,8-tetramethyl-5-prop-1-enyltridec-1-ene |
|---|---|
| PubChem CID | 123355574 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | 2,4,6,8-tetramethyl-5-prop-1-enyltridec-1-ene |
| SMILES | C=C(C)CC(C)C(C=CC)C(C)CC(C)CCCCC |
| InChI | InChI=1S/C20H38/c1-8-10-11-13-17(5)15-19(7)20(12-9-2)18(6)14-16(3)4/h9,12,17-20H,3,8,10-11,13-15H2,1-2,4-7H3 |
| InChIKey | UKULMJHJSZYNPV-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|