About 5-ethyl-2,4-dimethylnon-1-ene
5-ethyl-2,4-dimethylnon-1-ene (PubChem CID 145461999) has the molecular formula C13H26
and a molecular weight of 182.35 g/mol. Its IUPAC name is 5-ethyl-2,4-dimethylnon-1-ene.
Molecular Properties
| Compound Name | 5-ethyl-2,4-dimethylnon-1-ene |
| PubChem CID | 145461999 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 5-ethyl-2,4-dimethylnon-1-ene |
| SMILES | C=C(C)CC(C)C(CC)CCCC |
| InChI | InChI=1S/C13H26/c1-6-8-9-13(7-2)12(5)10-11(3)4/h12-13H,3,6-10H2,1-2,4-5H3 |
| InChIKey | PVGNXECMNPUUEU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2,4-dimethylnon-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,4-dimethylnon-1-ene?
The IUPAC name of 5-ethyl-2,4-dimethylnon-1-ene (CID 145461999) is 5-ethyl-2,4-dimethylnon-1-ene.
What is the SMILES notation for 5-ethyl-2,4-dimethylnon-1-ene?
The canonical SMILES for 5-ethyl-2,4-dimethylnon-1-ene is C=C(C)CC(C)C(CC)CCCC.
What is the InChIKey of 5-ethyl-2,4-dimethylnon-1-ene?
The InChIKey is PVGNXECMNPUUEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26/c1-6-8-9-13(7-2)12(5)10-11(3)4/h12-13H,3,6-10H2,1-2,4-5H3.
What are the key properties of 5-ethyl-2,4-dimethylnon-1-ene?
5-ethyl-2,4-dimethylnon-1-ene has a molecular weight of 182.35 g/mol, XLogP of 4.81, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,4-dimethylnon-1-ene is sourced from PubChem (CID 145461999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).