C13H22 — CID 91203633
2-methyl-5-prop-1-enylnona-1,8-diene (PubChem CID 91203633) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 2-methyl-5-prop-1-enylnona-1,8-diene.
| Compound Name | 2-methyl-5-prop-1-enylnona-1,8-diene |
|---|---|
| PubChem CID | 91203633 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 2-methyl-5-prop-1-enylnona-1,8-diene |
| SMILES | C=CCCC(C=CC)CCC(=C)C |
| InChI | InChI=1S/C13H22/c1-5-7-9-13(8-6-2)11-10-12(3)4/h5-6,8,13H,1,3,7,9-11H2,2,4H3 |
| InChIKey | CPKCUPZDGLRMDB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|