About ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene
ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene (PubChem CID 176715177) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene.
Molecular Properties
| Compound Name | ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene |
| PubChem CID | 176715177 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene |
| SMILES | C=C(C)CC.C=CCC[C@H](C)C=C.CC |
| InChI | InChI=1S/C8H14.C5H10.C2H6/c1-4-6-7-8(3)5-2;1-4-5(2)3;1-2/h4-5,8H,1-2,6-7H2,3H3;2,4H2,1,3H3;1-2H3/t8-;;/m1../s1 |
| InChIKey | HLRUPZLOZSAQFZ-YCBDHFTFSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene?
The IUPAC name of ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene (CID 176715177) is ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene.
What is the SMILES notation for ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene?
The canonical SMILES for ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene is C=C(C)CC.C=CCC[C@H](C)C=C.CC.
What is the InChIKey of ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene?
The InChIKey is HLRUPZLOZSAQFZ-YCBDHFTFSA-N. The full InChI is InChI=1S/C8H14.C5H10.C2H6/c1-4-6-7-8(3)5-2;1-4-5(2)3;1-2/h4-5,8H,1-2,6-7H2,3H3;2,4H2,1,3H3;1-2H3/t8-;;/m1../s1.
What are the key properties of ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene?
ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene has a molecular weight of 210.40 g/mol, XLogP of 5.77, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene is sourced from PubChem (CID 176715177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).