C15H30 — CID 176715177
ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene (PubChem CID 176715177) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene.
| Compound Name | ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene |
|---|---|
| PubChem CID | 176715177 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | ethane;2-methylbut-1-ene;(3S)-3-methylhepta-1,6-diene |
| SMILES | C=C(C)CC.C=CCC[C@H](C)C=C.CC |
| InChI | InChI=1S/C8H14.C5H10.C2H6/c1-4-6-7-8(3)5-2;1-4-5(2)3;1-2/h4-5,8H,1-2,6-7H2,3H3;2,4H2,1,3H3;1-2H3/t8-;;/m1../s1 |
| InChIKey | HLRUPZLOZSAQFZ-YCBDHFTFSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|