C28H52 — CID 162195902
8-methyl-5-prop-1-en-2-yldec-1-ene (PubChem CID 162195902) has the molecular formula C28H52 and a molecular weight of 388.72 g/mol. Its IUPAC name is 8-methyl-5-prop-1-en-2-yldec-1-ene.
| Compound Name | 8-methyl-5-prop-1-en-2-yldec-1-ene |
|---|---|
| PubChem CID | 162195902 |
| Molecular Formula | C28H52 |
| Molecular Weight | 388.72 g/mol |
| Exact Mass | 388.41 |
| IUPAC Name | 8-methyl-5-prop-1-en-2-yldec-1-ene |
| SMILES | C=CCCC(CCC(C)CC)C(=C)C.C=CCCC(CCC(C)CC)C(=C)C |
| InChI | InChI=1S/2C14H26/c2*1-6-8-9-14(12(3)4)11-10-13(5)7-2/h2*6,13-14H,1,3,7-11H2,2,4-5H3 |
| InChIKey | ZQXVJLLICJEIFC-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.72 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|