C15H26 — CID 162828118
(5S,8R)-2,8-dimethyl-5-prop-1-en-2-yldeca-1,9-diene (PubChem CID 162828118) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (5S,8R)-2,8-dimethyl-5-prop-1-en-2-yldeca-1,9-diene.
| Compound Name | (5S,8R)-2,8-dimethyl-5-prop-1-en-2-yldeca-1,9-diene |
|---|---|
| PubChem CID | 162828118 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (5S,8R)-2,8-dimethyl-5-prop-1-en-2-yldeca-1,9-diene |
| SMILES | C=C[C@H](C)CCC(CCC(=C)C)C(=C)C |
| InChI | InChI=1S/C15H26/c1-7-14(6)9-11-15(13(4)5)10-8-12(2)3/h7,14-15H,1-2,4,8-11H2,3,5-6H3/t14-,15?/m0/s1 |
| InChIKey | QLJDIDJHRGOWHJ-MLCCFXAWSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|