C13H24 — CID 173245384
3,9-dimethylundeca-1,6-diene (PubChem CID 173245384) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 3,9-dimethylundeca-1,6-diene.
| Compound Name | 3,9-dimethylundeca-1,6-diene |
|---|---|
| PubChem CID | 173245384 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 3,9-dimethylundeca-1,6-diene |
| SMILES | C=CC(C)CCC=CCC(C)CC |
| InChI | InChI=1S/C13H24/c1-5-12(3)10-8-7-9-11-13(4)6-2/h5,7,9,12-13H,1,6,8,10-11H2,2-4H3 |
| InChIKey | QYHNWKDCEIVRDV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|