About 7-methylnon-4-enenitrile
7-methylnon-4-enenitrile (PubChem CID 123692329) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 7-methylnon-4-enenitrile.
Molecular Properties
| Compound Name | 7-methylnon-4-enenitrile |
| PubChem CID | 123692329 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 7-methylnon-4-enenitrile |
| SMILES | CCC(C)CC=CCCC#N |
| InChI | InChI=1S/C10H17N/c1-3-10(2)8-6-4-5-7-9-11/h4,6,10H,3,5,7-8H2,1-2H3 |
| InChIKey | QEPHUOVZEBRPLO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methylnon-4-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylnon-4-enenitrile?
The IUPAC name of 7-methylnon-4-enenitrile (CID 123692329) is 7-methylnon-4-enenitrile.
What is the SMILES notation for 7-methylnon-4-enenitrile?
The canonical SMILES for 7-methylnon-4-enenitrile is CCC(C)CC=CCCC#N.
What is the InChIKey of 7-methylnon-4-enenitrile?
The InChIKey is QEPHUOVZEBRPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-3-10(2)8-6-4-5-7-9-11/h4,6,10H,3,5,7-8H2,1-2H3.
What are the key properties of 7-methylnon-4-enenitrile?
7-methylnon-4-enenitrile has a molecular weight of 151.25 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylnon-4-enenitrile is sourced from PubChem (CID 123692329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).