C12H23N — CID 139564567
(3E)-N,3,6-trimethylnona-1,3-dien-2-amine (PubChem CID 139564567) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (3E)-N,3,6-trimethylnona-1,3-dien-2-amine.
| Compound Name | (3E)-N,3,6-trimethylnona-1,3-dien-2-amine |
|---|---|
| PubChem CID | 139564567 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (3E)-N,3,6-trimethylnona-1,3-dien-2-amine |
| SMILES | C=C(NC)/C(C)=C/CC(C)CCC |
| InChI | InChI=1S/C12H23N/c1-6-7-10(2)8-9-11(3)12(4)13-5/h9-10,13H,4,6-8H2,1-3,5H3/b11-9+ |
| InChIKey | YLUQNCCCZWALHD-PKNBQFBNSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|