C18H35N — CID 143363500
ethane;2-methylpropane;(3E,5E)-N,3,6,7-tetramethylocta-1,3,5,7-tetraen-2-amine (PubChem CID 143363500) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is ethane;2-methylpropane;(3E,5E)-N,3,6,7-tetramethylocta-1,3,5,7-tetraen-2-amine.
| Compound Name | ethane;2-methylpropane;(3E,5E)-N,3,6,7-tetramethylocta-1,3,5,7-tetraen-2-amine |
|---|---|
| PubChem CID | 143363500 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | ethane;2-methylpropane;(3E,5E)-N,3,6,7-tetramethylocta-1,3,5,7-tetraen-2-amine |
| SMILES | C=C(C)/C(C)=C/C=C(\C)C(=C)NC.CC.CC(C)C |
| InChI | InChI=1S/C12H19N.C4H10.C2H6/c1-9(2)10(3)7-8-11(4)12(5)13-6;1-4(2)3;1-2/h7-8,13H,1,5H2,2-4,6H3;4H,1-3H3;1-2H3/b10-7+,11-8+;; |
| InChIKey | HHUQQJYLLCCEQG-VHZUSOFISA-N |
| XLogP | 5.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|