C19H33N — CID 164546966
ethane;(4Z,6E)-N,2,4,7,8-pentamethyl-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-3-amine (PubChem CID 164546966) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is ethane;(4Z,6E)-N,2,4,7,8-pentamethyl-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-3-amine.
| Compound Name | ethane;(4Z,6E)-N,2,4,7,8-pentamethyl-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-3-amine |
|---|---|
| PubChem CID | 164546966 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | ethane;(4Z,6E)-N,2,4,7,8-pentamethyl-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-3-amine |
| SMILES | C=C(C)C(/C=C(\C)C(=C)C)=C(/C)C(NC)=C(C)C.CC |
| InChI | InChI=1S/C17H27N.C2H6/c1-11(2)14(7)10-16(12(3)4)15(8)17(18-9)13(5)6;1-2/h10,18H,1,3H2,2,4-9H3;1-2H3/b14-10+,16-15-; |
| InChIKey | ADTQZGXVAIEXTK-CAMUHGCGSA-N |
| XLogP | 5.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|