C8H12S — CID 176921719
(3E)-4,5-dimethylhexa-1,3,5-triene-2-thiol (PubChem CID 176921719) has the molecular formula C8H12S and a molecular weight of 140.25 g/mol. Its IUPAC name is (3E)-4,5-dimethylhexa-1,3,5-triene-2-thiol.
| Compound Name | (3E)-4,5-dimethylhexa-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 176921719 |
| Molecular Formula | C8H12S |
| Molecular Weight | 140.25 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | (3E)-4,5-dimethylhexa-1,3,5-triene-2-thiol |
| SMILES | C=C(S)/C=C(\C)C(=C)C |
| InChI | InChI=1S/C8H12S/c1-6(2)7(3)5-8(4)9/h5,9H,1,4H2,2-3H3/b7-5+ |
| InChIKey | HAHPRYKIQJDZPN-FNORWQNLSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|