C8H11Tl — CID 142529132
[(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]thallium (PubChem CID 142529132) has the molecular formula C8H11Tl and a molecular weight of 311.56 g/mol. Its IUPAC name is [(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]thallium.
| Compound Name | [(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]thallium |
|---|---|
| PubChem CID | 142529132 |
| Molecular Formula | C8H11Tl |
| Molecular Weight | 311.56 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | [(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]thallium |
| SMILES | C=C(C)/C=C(/[Tl])C(=C)C |
| InChI | InChI=1S/C8H11.Tl/c1-7(2)5-6-8(3)4;/h5H,1,3H2,2,4H3; |
| InChIKey | JXGIEGHALSMJCM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.56 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|