C16H23F — CID 145172629
(3Z)-2,5-dimethylhexa-1,3,5-triene;(3E)-3-fluoro-2,5-dimethylhexa-1,3,5-triene (PubChem CID 145172629) has the molecular formula C16H23F and a molecular weight of 234.36 g/mol. Its IUPAC name is (3Z)-2,5-dimethylhexa-1,3,5-triene;(3E)-3-fluoro-2,5-dimethylhexa-1,3,5-triene.
| Compound Name | (3Z)-2,5-dimethylhexa-1,3,5-triene;(3E)-3-fluoro-2,5-dimethylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 145172629 |
| Molecular Formula | C16H23F |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (3Z)-2,5-dimethylhexa-1,3,5-triene;(3E)-3-fluoro-2,5-dimethylhexa-1,3,5-triene |
| SMILES | C=C(C)/C=C(/F)C(=C)C.C=C(C)/C=C\C(=C)C |
| InChI | InChI=1S/C8H11F.C8H12/c1-6(2)5-8(9)7(3)4;1-7(2)5-6-8(3)4/h5H,1,3H2,2,4H3;5-6H,1,3H2,2,4H3/b8-5+;6-5- |
| InChIKey | LBUHKSNVOSBBSB-DKSVKKINSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|