C11H17F — CID 166121568
(3E)-4-fluoro-2,6,6-trimethyl-5-methylidenehepta-1,3-diene (PubChem CID 166121568) has the molecular formula C11H17F and a molecular weight of 168.25 g/mol. Its IUPAC name is (3E)-4-fluoro-2,6,6-trimethyl-5-methylidenehepta-1,3-diene.
| Compound Name | (3E)-4-fluoro-2,6,6-trimethyl-5-methylidenehepta-1,3-diene |
|---|---|
| PubChem CID | 166121568 |
| Molecular Formula | C11H17F |
| Molecular Weight | 168.25 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3E)-4-fluoro-2,6,6-trimethyl-5-methylidenehepta-1,3-diene |
| SMILES | C=C(C)/C=C(/F)C(=C)C(C)(C)C |
| InChI | InChI=1S/C11H17F/c1-8(2)7-10(12)9(3)11(4,5)6/h7H,1,3H2,2,4-6H3/b10-7+ |
| InChIKey | UZZNZSQJIWPCKY-JXMROGBWSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|