C11H19FO — CID 143383116
(3E)-3-fluoro-2-methoxy-5-methylhexa-1,3,5-triene;propane (PubChem CID 143383116) has the molecular formula C11H19FO and a molecular weight of 186.27 g/mol. Its IUPAC name is (3E)-3-fluoro-2-methoxy-5-methylhexa-1,3,5-triene;propane.
| Compound Name | (3E)-3-fluoro-2-methoxy-5-methylhexa-1,3,5-triene;propane |
|---|---|
| PubChem CID | 143383116 |
| Molecular Formula | C11H19FO |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (3E)-3-fluoro-2-methoxy-5-methylhexa-1,3,5-triene;propane |
| SMILES | C=C(C)/C=C(/F)C(=C)OC.CCC |
| InChI | InChI=1S/C8H11FO.C3H8/c1-6(2)5-8(9)7(3)10-4;1-3-2/h5H,1,3H2,2,4H3;3H2,1-2H3/b8-5+; |
| InChIKey | OPERDCZZAIOZQQ-HAAWTFQLSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|