C20H27FO3 — CID 145122260
(3E,7E)-7-fluoro-2-methoxy-4-(methoxymethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;2-methylprop-2-enal (PubChem CID 145122260) has the molecular formula C20H27FO3 and a molecular weight of 334.43 g/mol. Its IUPAC name is (3E,7E)-7-fluoro-2-methoxy-4-(methoxymethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;2-methylprop-2-enal.
| Compound Name | (3E,7E)-7-fluoro-2-methoxy-4-(methoxymethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145122260 |
| Molecular Formula | C20H27FO3 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (3E,7E)-7-fluoro-2-methoxy-4-(methoxymethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;2-methylprop-2-enal |
| SMILES | C=C(C)/C=C(/F)C(=C)C(=C)/C(=C\C(=C)OC)COC.C=C(C)C=O |
| InChI | InChI=1S/C16H21FO2.C4H6O/c1-11(2)8-16(17)14(5)13(4)15(10-18-6)9-12(3)19-7;1-4(2)3-5/h8-9H,1,3-5,10H2,2,6-7H3;3H,1H2,2H3/b15-9-,16-8+; |
| InChIKey | YCOFOJKFYKIFRZ-MOBKBYBYSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|