About 2-methoxyethanamine;2-methylprop-2-enal
2-methoxyethanamine;2-methylprop-2-enal (PubChem CID 144696365) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-methoxyethanamine;2-methylprop-2-enal.
Molecular Properties
| Compound Name | 2-methoxyethanamine;2-methylprop-2-enal |
| PubChem CID | 144696365 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 2-methoxyethanamine;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.COCCN |
| InChI | InChI=1S/C4H6O.C3H9NO/c1-4(2)3-5;1-5-3-2-4/h3H,1H2,2H3;2-4H2,1H3 |
| InChIKey | KEVDXULYZALOLX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethanamine;2-methylprop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethanamine;2-methylprop-2-enal?
The IUPAC name of 2-methoxyethanamine;2-methylprop-2-enal (CID 144696365) is 2-methoxyethanamine;2-methylprop-2-enal.
What is the SMILES notation for 2-methoxyethanamine;2-methylprop-2-enal?
The canonical SMILES for 2-methoxyethanamine;2-methylprop-2-enal is C=C(C)C=O.COCCN.
What is the InChIKey of 2-methoxyethanamine;2-methylprop-2-enal?
The InChIKey is KEVDXULYZALOLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O.C3H9NO/c1-4(2)3-5;1-5-3-2-4/h3H,1H2,2H3;2-4H2,1H3.
What are the key properties of 2-methoxyethanamine;2-methylprop-2-enal?
2-methoxyethanamine;2-methylprop-2-enal has a molecular weight of 145.20 g/mol, XLogP of 0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethanamine;2-methylprop-2-enal is sourced from PubChem (CID 144696365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).