C12H24O3 — CID 169147946
2-(methoxymethyl)-3,3-dimethylbutan-1-ol;2-methylprop-2-enal (PubChem CID 169147946) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-(methoxymethyl)-3,3-dimethylbutan-1-ol;2-methylprop-2-enal.
| Compound Name | 2-(methoxymethyl)-3,3-dimethylbutan-1-ol;2-methylprop-2-enal |
|---|---|
| PubChem CID | 169147946 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 2-(methoxymethyl)-3,3-dimethylbutan-1-ol;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.COCC(CO)C(C)(C)C |
| InChI | InChI=1S/C8H18O2.C4H6O/c1-8(2,3)7(5-9)6-10-4;1-4(2)3-5/h7,9H,5-6H2,1-4H3;3H,1H2,2H3 |
| InChIKey | KFBRFXUVXXEYRT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|