C24H44O3 — CID 142282398
(8E)-11-ethyl-2-(methoxymethyl)-4,7,8-trimethyltrideca-8,10-dien-1-ol;2-methylprop-2-enal (PubChem CID 142282398) has the molecular formula C24H44O3 and a molecular weight of 380.61 g/mol. Its IUPAC name is (8E)-11-ethyl-2-(methoxymethyl)-4,7,8-trimethyltrideca-8,10-dien-1-ol;2-methylprop-2-enal.
| Compound Name | (8E)-11-ethyl-2-(methoxymethyl)-4,7,8-trimethyltrideca-8,10-dien-1-ol;2-methylprop-2-enal |
|---|---|
| PubChem CID | 142282398 |
| Molecular Formula | C24H44O3 |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | (8E)-11-ethyl-2-(methoxymethyl)-4,7,8-trimethyltrideca-8,10-dien-1-ol;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.CCC(=C/C=C(\C)C(C)CCC(C)CC(CO)COC)CC |
| InChI | InChI=1S/C20H38O2.C4H6O/c1-7-19(8-2)12-11-18(5)17(4)10-9-16(3)13-20(14-21)15-22-6;1-4(2)3-5/h11-12,16-17,20-21H,7-10,13-15H2,1-6H3;3H,1H2,2H3/b18-11+; |
| InChIKey | XHZMKFNODHWZMN-NWBUNABESA-N |
| XLogP | 6.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|