C34H50O3 — CID 142282835
2-[[2-ethyl-4-[4-(4-pentylphenyl)phenyl]cyclohexyl]methyl]-3-methoxypropan-1-ol;2-methylprop-2-enal (PubChem CID 142282835) has the molecular formula C34H50O3 and a molecular weight of 506.77 g/mol. Its IUPAC name is 2-[[2-ethyl-4-[4-(4-pentylphenyl)phenyl]cyclohexyl]methyl]-3-methoxypropan-1-ol;2-methylprop-2-enal.
| Compound Name | 2-[[2-ethyl-4-[4-(4-pentylphenyl)phenyl]cyclohexyl]methyl]-3-methoxypropan-1-ol;2-methylprop-2-enal |
|---|---|
| PubChem CID | 142282835 |
| Molecular Formula | C34H50O3 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | 2-[[2-ethyl-4-[4-(4-pentylphenyl)phenyl]cyclohexyl]methyl]-3-methoxypropan-1-ol;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.CCCCCc1ccc(-c2ccc(C3CCC(CC(CO)COC)C(CC)C3)cc2)cc1 |
| InChI | InChI=1S/C30H44O2.C4H6O/c1-4-6-7-8-23-9-11-26(12-10-23)27-13-15-28(16-14-27)30-18-17-29(25(5-2)20-30)19-24(21-31)22-32-3;1-4(2)3-5/h9-16,24-25,29-31H,4-8,17-22H2,1-3H3;3H,1H2,2H3 |
| InChIKey | HMYRGLQGBJBWHY-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|