C42H62O3 — CID 145411414
[2-[[2-ethyl-4-[4-[4-(3-ethyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]methyl]-3-methoxypropyl] 2-methylprop-2-enoate (PubChem CID 145411414) has the molecular formula C42H62O3 and a molecular weight of 614.95 g/mol. Its IUPAC name is [2-[[2-ethyl-4-[4-[4-(3-ethyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]methyl]-3-methoxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[2-ethyl-4-[4-[4-(3-ethyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]methyl]-3-methoxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145411414 |
| Molecular Formula | C42H62O3 |
| Molecular Weight | 614.95 g/mol |
| Exact Mass | 614.47 |
| IUPAC Name | [2-[[2-ethyl-4-[4-[4-(3-ethyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]methyl]-3-methoxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC)CC1CCC(C2CCC(c3ccc(-c4ccc(CCCCC)c(CC)c4)cc3)CC2)CC1CC |
| InChI | InChI=1S/C42H62O3/c1-7-10-11-12-34-21-22-40(26-32(34)8-2)37-17-13-35(14-18-37)36-15-19-38(20-16-36)41-24-23-39(33(9-3)27-41)25-31(28-44-6)29-45-42(43)30(4)5/h13-14,17-18,21-22,26,31,33,36,38-39,41H,4,7-12,15-16,19-20,23-25,27-29H2,1-3,5-6H3 |
| InChIKey | BCACSNBCWQXFJM-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.95 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|