C33H52O3 — CID 138529255
[2-[[(3S)-3-ethyl-4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 138529255) has the molecular formula C33H52O3 and a molecular weight of 496.78 g/mol. Its IUPAC name is [2-[[(3S)-3-ethyl-4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[(3S)-3-ethyl-4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138529255 |
| Molecular Formula | C33H52O3 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.39 |
| IUPAC Name | [2-[[(3S)-3-ethyl-4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)CC1CCC(C2CCC(c3ccc(CCCCC)cc3)CC2)[C@@H](CC)C1 |
| InChI | InChI=1S/C33H52O3/c1-5-7-8-9-25-10-13-29(14-11-25)30-15-17-31(18-16-30)32-19-12-26(21-28(32)6-2)20-27(22-34)23-36-33(35)24(3)4/h10-11,13-14,26-28,30-32,34H,3,5-9,12,15-23H2,1-2,4H3/t26?,27?,28-,30?,31?,32?/m0/s1 |
| InChIKey | BKZPORUPANCSBX-ZDZKYLRFSA-N |
| XLogP | 8.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|