C39H63NO4 — CID 142282403
[2-[[2-[(dimethylamino)methyl]-1-hydroxyprop-2-enoxy]methyl]-5-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]pentyl] 2-methylprop-2-enoate (PubChem CID 142282403) has the molecular formula C39H63NO4 and a molecular weight of 609.94 g/mol. Its IUPAC name is [2-[[2-[(dimethylamino)methyl]-1-hydroxyprop-2-enoxy]methyl]-5-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]pentyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[2-[(dimethylamino)methyl]-1-hydroxyprop-2-enoxy]methyl]-5-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142282403 |
| Molecular Formula | C39H63NO4 |
| Molecular Weight | 609.94 g/mol |
| Exact Mass | 609.48 |
| IUPAC Name | [2-[[2-[(dimethylamino)methyl]-1-hydroxyprop-2-enoxy]methyl]-5-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCCC1CCC(C2CCC(c3ccc(CCCCC)cc3)CC2)CC1)COC(O)C(=C)CN(C)C |
| InChI | InChI=1S/C39H63NO4/c1-7-8-9-11-31-14-18-34(19-15-31)36-22-24-37(25-23-36)35-20-16-32(17-21-35)12-10-13-33(27-43-38(41)29(2)3)28-44-39(42)30(4)26-40(5)6/h14-15,18-19,32-33,35-37,39,42H,2,4,7-13,16-17,20-28H2,1,3,5-6H3 |
| InChIKey | VHPQVIFGMGNZOP-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.94 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|