C31H48O4 — CID 138529164
[2-(formyloxymethyl)-5-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]pentyl] formate (PubChem CID 138529164) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is [2-(formyloxymethyl)-5-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]pentyl] formate.
| Compound Name | [2-(formyloxymethyl)-5-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]pentyl] formate |
|---|---|
| PubChem CID | 138529164 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | [2-(formyloxymethyl)-5-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]pentyl] formate |
| SMILES | CCCCCc1ccc(C2CCC(C3CCC(CCCC(COC=O)COC=O)CC3)CC2)cc1 |
| InChI | InChI=1S/C31H48O4/c1-2-3-4-6-25-9-13-28(14-10-25)30-17-19-31(20-18-30)29-15-11-26(12-16-29)7-5-8-27(21-34-23-32)22-35-24-33/h9-10,13-14,23-24,26-27,29-31H,2-8,11-12,15-22H2,1H3 |
| InChIKey | IEBQJBKHXQITSU-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|