C35H54O7 — CID 134244593
[3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]-2-[5-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]oxan-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134244593) has the molecular formula C35H54O7 and a molecular weight of 586.81 g/mol. Its IUPAC name is [3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]-2-[5-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]oxan-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]-2-[5-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]oxan-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134244593 |
| Molecular Formula | C35H54O7 |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.39 |
| IUPAC Name | [3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]-2-[5-[2-[4-(4-pentylphenyl)cyclohexyl]ethyl]oxan-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC(O)C(=C)CO)C1CCC(CCC2CCC(c3ccc(CCCCC)cc3)CC2)CO1 |
| InChI | InChI=1S/C35H54O7/c1-4-5-6-7-27-10-15-30(16-11-27)31-17-12-28(13-18-31)8-9-29-14-19-33(40-22-29)32(23-41-34(38)25(2)20-36)24-42-35(39)26(3)21-37/h10-11,15-16,28-29,31-34,36-38H,2-9,12-14,17-24H2,1H3 |
| InChIKey | ZXACISIPHDBUHF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|