C26H40O4 — CID 134244657
[4-hydroxy-3-[5-[2-(4-pentylphenyl)ethyl]oxan-2-yl]butyl] 2-methylprop-2-enoate (PubChem CID 134244657) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is [4-hydroxy-3-[5-[2-(4-pentylphenyl)ethyl]oxan-2-yl]butyl] 2-methylprop-2-enoate.
| Compound Name | [4-hydroxy-3-[5-[2-(4-pentylphenyl)ethyl]oxan-2-yl]butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134244657 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [4-hydroxy-3-[5-[2-(4-pentylphenyl)ethyl]oxan-2-yl]butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(CO)C1CCC(CCc2ccc(CCCCC)cc2)CO1 |
| InChI | InChI=1S/C26H40O4/c1-4-5-6-7-21-8-10-22(11-9-21)12-13-23-14-15-25(30-19-23)24(18-27)16-17-29-26(28)20(2)3/h8-11,23-25,27H,2,4-7,12-19H2,1,3H3 |
| InChIKey | BCBWNEYZLZZYEL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|