C36H56O7 — CID 145412018
[2-(formyloxymethyl)-3-[4-[5-[2-(4-pentylphenyl)ethyl]-1,3-dioxan-2-yl]cyclohexyl]propyl] 2-methylprop-2-enoate;2-methylprop-2-en-1-ol (PubChem CID 145412018) has the molecular formula C36H56O7 and a molecular weight of 600.84 g/mol. Its IUPAC name is [2-(formyloxymethyl)-3-[4-[5-[2-(4-pentylphenyl)ethyl]-1,3-dioxan-2-yl]cyclohexyl]propyl] 2-methylprop-2-enoate;2-methylprop-2-en-1-ol.
| Compound Name | [2-(formyloxymethyl)-3-[4-[5-[2-(4-pentylphenyl)ethyl]-1,3-dioxan-2-yl]cyclohexyl]propyl] 2-methylprop-2-enoate;2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 145412018 |
| Molecular Formula | C36H56O7 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.40 |
| IUPAC Name | [2-(formyloxymethyl)-3-[4-[5-[2-(4-pentylphenyl)ethyl]-1,3-dioxan-2-yl]cyclohexyl]propyl] 2-methylprop-2-enoate;2-methylprop-2-en-1-ol |
| SMILES | C=C(C)C(=O)OCC(COC=O)CC1CCC(C2OCC(CCc3ccc(CCCCC)cc3)CO2)CC1.C=C(C)CO |
| InChI | InChI=1S/C32H48O6.C4H8O/c1-4-5-6-7-25-8-10-26(11-9-25)12-13-28-20-37-32(38-21-28)30-16-14-27(15-17-30)18-29(19-35-23-33)22-36-31(34)24(2)3;1-4(2)3-5/h8-11,23,27-30,32H,2,4-7,12-22H2,1,3H3;5H,1,3H2,2H3 |
| InChIKey | KIIFWRKGCDEKEE-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|