C38H54O5 — CID 134245268
[2-(2-methylprop-2-enoyloxymethyl)-6-[4-[2-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)ethyl]phenyl]hexyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134245268) has the molecular formula C38H54O5 and a molecular weight of 590.85 g/mol. Its IUPAC name is [2-(2-methylprop-2-enoyloxymethyl)-6-[4-[2-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)ethyl]phenyl]hexyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-(2-methylprop-2-enoyloxymethyl)-6-[4-[2-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)ethyl]phenyl]hexyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134245268 |
| Molecular Formula | C38H54O5 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.40 |
| IUPAC Name | [2-(2-methylprop-2-enoyloxymethyl)-6-[4-[2-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)ethyl]phenyl]hexyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCCCc1ccc(CCC2CCC3C=C(CCCCC)C=CC3C2)cc1)COC(=O)C(=C)CO |
| InChI | InChI=1S/C38H54O5/c1-5-6-7-11-32-19-21-36-24-33(20-22-35(36)23-32)18-17-31-15-13-30(14-16-31)10-8-9-12-34(26-42-37(40)28(2)3)27-43-38(41)29(4)25-39/h13-16,19,21,23,33-36,39H,2,4-12,17-18,20,22,24-27H2,1,3H3 |
| InChIKey | GXTHCMFNTNQGFH-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|